C16H13ClFN3 — CID 114591379
4-chloro-2-(3-fluorophenyl)-N,N-dimethylquinazolin-6-amine (PubChem CID 114591379) has the molecular formula C16H13ClFN3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 4-chloro-2-(3-fluorophenyl)-N,N-dimethylquinazolin-6-amine.
| Compound Name | 4-chloro-2-(3-fluorophenyl)-N,N-dimethylquinazolin-6-amine |
|---|---|
| PubChem CID | 114591379 |
| Molecular Formula | C16H13ClFN3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-chloro-2-(3-fluorophenyl)-N,N-dimethylquinazolin-6-amine |
| SMILES | CN(C)c1ccc2nc(-c3cccc(F)c3)nc(Cl)c2c1 |
| InChI | InChI=1S/C16H13ClFN3/c1-21(2)12-6-7-14-13(9-12)15(17)20-16(19-14)10-4-3-5-11(18)8-10/h3-9H,1-2H3 |
| InChIKey | ALNSWAMCUZQARF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |