C16H14ClN3 — CID 43329184
3-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline (PubChem CID 43329184) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline.
| Compound Name | 3-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 43329184 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-(4-chloroquinazolin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2nc(Cl)c3ccccc3n2)c1 |
| InChI | InChI=1S/C16H14ClN3/c1-20(2)12-7-5-6-11(10-12)16-18-14-9-4-3-8-13(14)15(17)19-16/h3-10H,1-2H3 |
| InChIKey | XTAAREHVJHFYJB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |