C20H27N3 — CID 90692707
N,N-dimethyl-2-phenylquinazolin-4-amine;ethane (PubChem CID 90692707) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is N,N-dimethyl-2-phenylquinazolin-4-amine;ethane.
| Compound Name | N,N-dimethyl-2-phenylquinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 90692707 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N,N-dimethyl-2-phenylquinazolin-4-amine;ethane |
| SMILES | CC.CC.CN(C)c1nc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C16H15N3.2C2H6/c1-19(2)16-13-10-6-7-11-14(13)17-15(18-16)12-8-4-3-5-9-12;2*1-2/h3-11H,1-2H3;2*1-2H3 |
| InChIKey | YQYYZGOVMTYLLD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |