C18H19N3O2 — CID 132524311
2-(3,4-dimethoxyphenyl)-N,N-dimethylquinazolin-4-amine (PubChem CID 132524311) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N,N-dimethylquinazolin-4-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 132524311 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N,N-dimethylquinazolin-4-amine |
| SMILES | COc1ccc(-c2nc(N(C)C)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C18H19N3O2/c1-21(2)18-13-7-5-6-8-14(13)19-17(20-18)12-9-10-15(22-3)16(11-12)23-4/h5-11H,1-4H3 |
| InChIKey | FRHMLOAYPYYNAZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |