C18H18ClN3O2 — CID 22997395
2-(4-chlorophenyl)-6,7-dimethoxy-N,N-dimethylquinazolin-4-amine (PubChem CID 22997395) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,7-dimethoxy-N,N-dimethylquinazolin-4-amine.
| Compound Name | 2-(4-chlorophenyl)-6,7-dimethoxy-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 22997395 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-(4-chlorophenyl)-6,7-dimethoxy-N,N-dimethylquinazolin-4-amine |
| SMILES | COc1cc2nc(-c3ccc(Cl)cc3)nc(N(C)C)c2cc1OC |
| InChI | InChI=1S/C18H18ClN3O2/c1-22(2)18-13-9-15(23-3)16(24-4)10-14(13)20-17(21-18)11-5-7-12(19)8-6-11/h5-10H,1-4H3 |
| InChIKey | SMDWCAYUFFWXJR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |