C25H35Cl3N4O2 — CID 22997445
1-N-[2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-yl]-1-N',1-N'-diethylpentane-1,1-diamine;dihydrochloride (PubChem CID 22997445) has the molecular formula C25H35Cl3N4O2 and a molecular weight of 529.94 g/mol. Its IUPAC name is 1-N-[2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-yl]-1-N',1-N'-diethylpentane-1,1-diamine;dihydrochloride.
| Compound Name | 1-N-[2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-yl]-1-N',1-N'-diethylpentane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 22997445 |
| Molecular Formula | C25H35Cl3N4O2 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 1-N-[2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-yl]-1-N',1-N'-diethylpentane-1,1-diamine;dihydrochloride |
| SMILES | CCCCC(Nc1nc(-c2ccc(Cl)cc2)nc2cc(OC)c(OC)cc12)N(CC)CC.Cl.Cl |
| InChI | InChI=1S/C25H33ClN4O2.2ClH/c1-6-9-10-23(30(7-2)8-3)28-25-19-15-21(31-4)22(32-5)16-20(19)27-24(29-25)17-11-13-18(26)14-12-17;;/h11-16,23H,6-10H2,1-5H3,(H,27,28,29);2*1H |
| InChIKey | PSXWXDOFYHAXGA-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|