C31H40N4O2 — CID 10278674
N',N'-dibutyl-N-(6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-yl)propane-1,3-diamine (PubChem CID 10278674) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N',N'-dibutyl-N-(6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-(6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10278674 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | N',N'-dibutyl-N-(6,7-dimethoxy-2-naphthalen-2-ylquinazolin-4-yl)propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNc1nc(-c2ccc3ccccc3c2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C31H40N4O2/c1-5-7-17-35(18-8-6-2)19-11-16-32-31-26-21-28(36-3)29(37-4)22-27(26)33-30(34-31)25-15-14-23-12-9-10-13-24(23)20-25/h9-10,12-15,20-22H,5-8,11,16-19H2,1-4H3,(H,32,33,34) |
| InChIKey | ARDPPFFPKJIJEN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|