C23H22N4O2 — CID 117093998
6,7-dimethoxy-2-phenyl-N-(2-pyridin-2-ylethyl)quinazolin-4-amine (PubChem CID 117093998) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 6,7-dimethoxy-2-phenyl-N-(2-pyridin-2-ylethyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-2-phenyl-N-(2-pyridin-2-ylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 117093998 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6,7-dimethoxy-2-phenyl-N-(2-pyridin-2-ylethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(-c3ccccc3)nc(NCCc3ccccn3)c2cc1OC |
| InChI | InChI=1S/C23H22N4O2/c1-28-20-14-18-19(15-21(20)29-2)26-22(16-8-4-3-5-9-16)27-23(18)25-13-11-17-10-6-7-12-24-17/h3-10,12,14-15H,11,13H2,1-2H3,(H,25,26,27) |
| InChIKey | WSTFBKQBTJZWMA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |