C20H18Cl2N4 — CID 45261670
2-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine;dihydrochloride (PubChem CID 45261670) has the molecular formula C20H18Cl2N4 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine;dihydrochloride.
| Compound Name | 2-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 45261670 |
| Molecular Formula | C20H18Cl2N4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2nc(NCc3ccccn3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H16N4.2ClH/c1-2-8-15(9-3-1)19-23-18-12-5-4-11-17(18)20(24-19)22-14-16-10-6-7-13-21-16;;/h1-13H,14H2,(H,22,23,24);2*1H |
| InChIKey | BKVMJSVFFCZACL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |