C19H16N6 — CID 3234103
N-[(5-methylpyrazin-2-yl)methyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 3234103) has the molecular formula C19H16N6 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[(5-methylpyrazin-2-yl)methyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(5-methylpyrazin-2-yl)methyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 3234103 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(5-methylpyrazin-2-yl)methyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | Cc1cnc(CNc2nc(-c3cccnc3)nc3ccccc23)cn1 |
| InChI | InChI=1S/C19H16N6/c1-13-9-22-15(11-21-13)12-23-19-16-6-2-3-7-17(16)24-18(25-19)14-5-4-8-20-10-14/h2-11H,12H2,1H3,(H,23,24,25) |
| InChIKey | XYPUDAZANYJVHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |