C25H25N5 — CID 9024551
2-pyridin-3-yl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 9024551) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 2-pyridin-3-yl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 9024551 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-pyridin-3-yl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | c1cncc(-c2nc(NCc3ccc(CN4CCCC4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H25N5/c1-2-8-23-22(7-1)25(29-24(28-23)21-6-5-13-26-17-21)27-16-19-9-11-20(12-10-19)18-30-14-3-4-15-30/h1-2,5-13,17H,3-4,14-16,18H2,(H,27,28,29) |
| InChIKey | GKOMPWZPYZZDLH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |