C25H26N5O+ — CID 9023704
N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 9023704) has the molecular formula C25H26N5O+ and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 9023704 |
| Molecular Formula | C25H26N5O+ |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | c1cncc(-c2nc(NCc3ccc(C[NH+]4CCOCC4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H25N5O/c1-2-6-23-22(5-1)25(29-24(28-23)21-4-3-11-26-17-21)27-16-19-7-9-20(10-8-19)18-30-12-14-31-15-13-30/h1-11,17H,12-16,18H2,(H,27,28,29)/p+1 |
| InChIKey | PSDKSBVJKJMYFM-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |