C20H19Cl2N5O2S — CID 19392360
4-[[(2-pyridin-3-ylquinazolin-4-yl)amino]methyl]benzenesulfonamide;dihydrochloride (PubChem CID 19392360) has the molecular formula C20H19Cl2N5O2S and a molecular weight of 464.38 g/mol. Its IUPAC name is 4-[[(2-pyridin-3-ylquinazolin-4-yl)amino]methyl]benzenesulfonamide;dihydrochloride.
| Compound Name | 4-[[(2-pyridin-3-ylquinazolin-4-yl)amino]methyl]benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 19392360 |
| Molecular Formula | C20H19Cl2N5O2S |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 4-[[(2-pyridin-3-ylquinazolin-4-yl)amino]methyl]benzenesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.NS(=O)(=O)c1ccc(CNc2nc(-c3cccnc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H17N5O2S.2ClH/c21-28(26,27)16-9-7-14(8-10-16)12-23-20-17-5-1-2-6-18(17)24-19(25-20)15-4-3-11-22-13-15;;/h1-11,13H,12H2,(H2,21,26,27)(H,23,24,25);2*1H |
| InChIKey | ZYETUNYKVASBCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |