C23H22N4O3 — CID 9024030
2-pyridin-3-yl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 9024030) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-pyridin-3-yl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 9024030 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-pyridin-3-yl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1cc(CNc2nc(-c3cccnc3)nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N4O3/c1-28-19-11-15(12-20(29-2)21(19)30-3)13-25-23-17-8-4-5-9-18(17)26-22(27-23)16-7-6-10-24-14-16/h4-12,14H,13H2,1-3H3,(H,25,26,27) |
| InChIKey | SDXUHTVCGQDTFM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |