C21H25N3O3 — CID 69312797
2-propyl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 69312797) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-propyl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-propyl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69312797 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-propyl-N-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | CCCc1nc(NCc2cc(OC)c(OC)c(OC)c2)c2ccccc2n1 |
| InChI | InChI=1S/C21H25N3O3/c1-5-8-19-23-16-10-7-6-9-15(16)21(24-19)22-13-14-11-17(25-2)20(27-4)18(12-14)26-3/h6-7,9-12H,5,8,13H2,1-4H3,(H,22,23,24) |
| InChIKey | KVMWJRUNSGGMKH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |