C21H26N4O3 — CID 95127666
2-(2-aminoethyl)-N-[(1S)-1-(3,4,5-trimethoxyphenyl)ethyl]quinazolin-4-amine (PubChem CID 95127666) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[(1S)-1-(3,4,5-trimethoxyphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 2-(2-aminoethyl)-N-[(1S)-1-(3,4,5-trimethoxyphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 95127666 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-(2-aminoethyl)-N-[(1S)-1-(3,4,5-trimethoxyphenyl)ethyl]quinazolin-4-amine |
| SMILES | COc1cc([C@H](C)Nc2nc(CCN)nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N4O3/c1-13(14-11-17(26-2)20(28-4)18(12-14)27-3)23-21-15-7-5-6-8-16(15)24-19(25-21)9-10-22/h5-8,11-13H,9-10,22H2,1-4H3,(H,23,24,25)/t13-/m0/s1 |
| InChIKey | JTXKMCFJUPPJBA-ZDUSSCGKSA-N |
| XLogP | 3.33 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |