C21H26N4O2 — CID 91966287
2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine (PubChem CID 91966287) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine.
| Compound Name | 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91966287 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine |
| SMILES | CCCNc1nc(NCCc2ccc(OC)c(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C21H26N4O2/c1-4-12-22-20-16-7-5-6-8-17(16)24-21(25-20)23-13-11-15-9-10-18(26-2)19(14-15)27-3/h5-10,14H,4,11-13H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | PXMFYXDQQTUPNB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |