C16H24N4 — CID 80753533
4-N-(3-methylbutan-2-yl)-2-N-propylquinazoline-2,4-diamine (PubChem CID 80753533) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-N-(3-methylbutan-2-yl)-2-N-propylquinazoline-2,4-diamine.
| Compound Name | 4-N-(3-methylbutan-2-yl)-2-N-propylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80753533 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-N-(3-methylbutan-2-yl)-2-N-propylquinazoline-2,4-diamine |
| SMILES | CCCNc1nc(NC(C)C(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C16H24N4/c1-5-10-17-16-19-14-9-7-6-8-13(14)15(20-16)18-12(4)11(2)3/h6-9,11-12H,5,10H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | XMIMEMRNIAVLLU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |