C15H22N4 — CID 80770804
2-N-ethyl-4-N-pentan-2-ylquinazoline-2,4-diamine (PubChem CID 80770804) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-N-ethyl-4-N-pentan-2-ylquinazoline-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-pentan-2-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80770804 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-N-ethyl-4-N-pentan-2-ylquinazoline-2,4-diamine |
| SMILES | CCCC(C)Nc1nc(NCC)nc2ccccc12 |
| InChI | InChI=1S/C15H22N4/c1-4-8-11(3)17-14-12-9-6-7-10-13(12)18-15(19-14)16-5-2/h6-7,9-11H,4-5,8H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | MWXDCHKYLGZJLX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |