C14H20N6O — CID 80901097
2-[(2-hydrazinylquinazolin-4-yl)amino]-N-propylpropanamide (PubChem CID 80901097) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-[(2-hydrazinylquinazolin-4-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(2-hydrazinylquinazolin-4-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 80901097 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[(2-hydrazinylquinazolin-4-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C14H20N6O/c1-3-8-16-13(21)9(2)17-12-10-6-4-5-7-11(10)18-14(19-12)20-15/h4-7,9H,3,8,15H2,1-2H3,(H,16,21)(H2,17,18,19,20) |
| InChIKey | OKVVVXAVSCLCQQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|