C15H19N3O — CID 61480226
N-propyl-2-(quinolin-4-ylamino)propanamide (PubChem CID 61480226) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-propyl-2-(quinolin-4-ylamino)propanamide.
| Compound Name | N-propyl-2-(quinolin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 61480226 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-propyl-2-(quinolin-4-ylamino)propanamide |
| SMILES | CCCNC(=O)C(C)Nc1ccnc2ccccc12 |
| InChI | InChI=1S/C15H19N3O/c1-3-9-17-15(19)11(2)18-14-8-10-16-13-7-5-4-6-12(13)14/h4-8,10-11H,3,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | BCOWFIPFJYSKIQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |