C17H25N5O — CID 110436209
N-[2-(diethylamino)ethyl]-2-(quinazolin-4-ylamino)propanamide (PubChem CID 110436209) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(quinazolin-4-ylamino)propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(quinazolin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 110436209 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(quinazolin-4-ylamino)propanamide |
| SMILES | CCN(CC)CCNC(=O)C(C)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C17H25N5O/c1-4-22(5-2)11-10-18-17(23)13(3)21-16-14-8-6-7-9-15(14)19-12-20-16/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,18,23)(H,19,20,21) |
| InChIKey | WVQILVTZNKVVSV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |