C16H22N4O3S — CID 126444405
(2S)-N-(2-ethylsulfonylethyl)-2-[(6-methylquinazolin-4-yl)amino]propanamide (PubChem CID 126444405) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2S)-N-(2-ethylsulfonylethyl)-2-[(6-methylquinazolin-4-yl)amino]propanamide.
| Compound Name | (2S)-N-(2-ethylsulfonylethyl)-2-[(6-methylquinazolin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 126444405 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (2S)-N-(2-ethylsulfonylethyl)-2-[(6-methylquinazolin-4-yl)amino]propanamide |
| SMILES | CCS(=O)(=O)CCNC(=O)[C@H](C)Nc1ncnc2ccc(C)cc12 |
| InChI | InChI=1S/C16H22N4O3S/c1-4-24(22,23)8-7-17-16(21)12(3)20-15-13-9-11(2)5-6-14(13)18-10-19-15/h5-6,9-10,12H,4,7-8H2,1-3H3,(H,17,21)(H,18,19,20)/t12-/m0/s1 |
| InChIKey | FXZBIPGRUITRBL-LBPRGKRZSA-N |
| XLogP | 1.29 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |