C20H26N6O — CID 131931125
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(6-methylquinazolin-4-yl)amino]propanamide (PubChem CID 131931125) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(6-methylquinazolin-4-yl)amino]propanamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(6-methylquinazolin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 131931125 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(6-methylquinazolin-4-yl)amino]propanamide |
| SMILES | Cc1ccc2ncnc(NC(C)C(=O)NCCCn3nc(C)cc3C)c2c1 |
| InChI | InChI=1S/C20H26N6O/c1-13-6-7-18-17(10-13)19(23-12-22-18)24-16(4)20(27)21-8-5-9-26-15(3)11-14(2)25-26/h6-7,10-12,16H,5,8-9H2,1-4H3,(H,21,27)(H,22,23,24) |
| InChIKey | CLMQZVJGGHTFBA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|