C19H34N4O2 — CID 52514829
(2R)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methylbutanamide (PubChem CID 52514829) has the molecular formula C19H34N4O2 and a molecular weight of 350.51 g/mol. Its IUPAC name is (2R)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methylbutanamide.
| Compound Name | (2R)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 52514829 |
| Molecular Formula | C19H34N4O2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methylbutanamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)[C@@H](C(C)C)N2C[C@@H](C)O[C@@H](C)C2)n1 |
| InChI | InChI=1S/C19H34N4O2/c1-13(2)18(22-11-16(5)25-17(6)12-22)19(24)20-8-7-9-23-15(4)10-14(3)21-23/h10,13,16-18H,7-9,11-12H2,1-6H3,(H,20,24)/t16-,17+,18-/m1/s1 |
| InChIKey | QLLWVIVNZSAJDI-FGTMMUONSA-N |
| XLogP | 2.14 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|