C17H24BrN5O — CID 163215900
(2S)-2-[(6-bromoquinazolin-4-yl)amino]-N-[2-(diethylamino)ethyl]propanamide (PubChem CID 163215900) has the molecular formula C17H24BrN5O and a molecular weight of 394.32 g/mol. Its IUPAC name is (2S)-2-[(6-bromoquinazolin-4-yl)amino]-N-[2-(diethylamino)ethyl]propanamide.
| Compound Name | (2S)-2-[(6-bromoquinazolin-4-yl)amino]-N-[2-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 163215900 |
| Molecular Formula | C17H24BrN5O |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2S)-2-[(6-bromoquinazolin-4-yl)amino]-N-[2-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)CCNC(=O)[C@H](C)Nc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C17H24BrN5O/c1-4-23(5-2)9-8-19-17(24)12(3)22-16-14-10-13(18)6-7-15(14)20-11-21-16/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,19,24)(H,20,21,22)/t12-/m0/s1 |
| InChIKey | MDIFPRXHQFPYPN-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |