C14H19IN4 — CID 23734239
N',N'-diethyl-N-(6-iodoquinazolin-4-yl)ethane-1,2-diamine (PubChem CID 23734239) has the molecular formula C14H19IN4 and a molecular weight of 370.24 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-iodoquinazolin-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(6-iodoquinazolin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 23734239 |
| Molecular Formula | C14H19IN4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N',N'-diethyl-N-(6-iodoquinazolin-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ncnc2ccc(I)cc12 |
| InChI | InChI=1S/C14H19IN4/c1-3-19(4-2)8-7-16-14-12-9-11(15)5-6-13(12)17-10-18-14/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,16,17,18) |
| InChIKey | IDZFTZJAHKCWQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|