C17H26N4O — CID 21003124
N',N'-diethyl-N-(7-methoxyquinazolin-4-yl)butane-1,4-diamine (PubChem CID 21003124) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N',N'-diethyl-N-(7-methoxyquinazolin-4-yl)butane-1,4-diamine.
| Compound Name | N',N'-diethyl-N-(7-methoxyquinazolin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 21003124 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N',N'-diethyl-N-(7-methoxyquinazolin-4-yl)butane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1ncnc2cc(OC)ccc12 |
| InChI | InChI=1S/C17H26N4O/c1-4-21(5-2)11-7-6-10-18-17-15-9-8-14(22-3)12-16(15)19-13-20-17/h8-9,12-13H,4-7,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | NBQKMHMNKNTHLP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|