C22H27FN4O — CID 155728509
N',N'-diethyl-N-[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]propane-1,3-diamine (PubChem CID 155728509) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is N',N'-diethyl-N-[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 155728509 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N',N'-diethyl-N-[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ncnc2c(OC)cc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C22H27FN4O/c1-4-27(5-2)12-6-11-24-22-19-13-17(16-7-9-18(23)10-8-16)14-20(28-3)21(19)25-15-26-22/h7-10,13-15H,4-6,11-12H2,1-3H3,(H,24,25,26) |
| InChIKey | MIRDBDCKHHIXRG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|