C21H18FN3OS — CID 155364863
(2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial (PubChem CID 155364863) has the molecular formula C21H18FN3OS and a molecular weight of 379.46 g/mol. Its IUPAC name is (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial.
| Compound Name | (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial |
|---|---|
| PubChem CID | 155364863 |
| Molecular Formula | C21H18FN3OS |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial |
| SMILES | C=C/C(=C\C=S)CNc1ncnc2c(OC)cc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H18FN3OS/c1-3-14(8-9-27)12-23-21-18-10-16(15-4-6-17(22)7-5-15)11-19(26-2)20(18)24-13-25-21/h3-11,13H,1,12H2,2H3,(H,23,24,25)/b14-8+ |
| InChIKey | MNMACDBFQJIJRN-RIYZIHGNSA-N |
| XLogP | 4.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|