About (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial
(2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial (PubChem CID 155364863) has the molecular formula C21H18FN3OS
and a molecular weight of 379.46 g/mol. Its IUPAC name is (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial.
Molecular Properties
| Compound Name | (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial |
| PubChem CID | 155364863 |
| Molecular Formula | C21H18FN3OS |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial |
| SMILES | C=C/C(=C\C=S)CNc1ncnc2c(OC)cc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H18FN3OS/c1-3-14(8-9-27)12-23-21-18-10-16(15-4-6-17(22)7-5-15)11-19(26-2)20(18)24-13-25-21/h3-11,13H,1,12H2,2H3,(H,23,24,25)/b14-8+ |
| InChIKey | MNMACDBFQJIJRN-RIYZIHGNSA-N |
| XLogP | 4.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial?
The IUPAC name of (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial (CID 155364863) is (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial.
What is the SMILES notation for (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial?
The canonical SMILES for (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial is C=C/C(=C\C=S)CNc1ncnc2c(OC)cc(-c3ccc(F)cc3)cc12.
What is the InChIKey of (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial?
The InChIKey is MNMACDBFQJIJRN-RIYZIHGNSA-N. The full InChI is InChI=1S/C21H18FN3OS/c1-3-14(8-9-27)12-23-21-18-10-16(15-4-6-17(22)7-5-15)11-19(26-2)20(18)24-13-25-21/h3-11,13H,1,12H2,2H3,(H,23,24,25)/b14-8+.
What are the key properties of (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial?
(2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial has a molecular weight of 379.46 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-[[[6-(4-fluorophenyl)-8-methoxyquinazolin-4-yl]amino]methyl]penta-2,4-dienethial is sourced from PubChem (CID 155364863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).