C24H30N4O2 — CID 155728729
N-[2-[(Z)-but-2-en-2-yl]oxyprop-2-enyl]-8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-amine;ethane (PubChem CID 155728729) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[2-[(Z)-but-2-en-2-yl]oxyprop-2-enyl]-8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-amine;ethane.
| Compound Name | N-[2-[(Z)-but-2-en-2-yl]oxyprop-2-enyl]-8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 155728729 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[2-[(Z)-but-2-en-2-yl]oxyprop-2-enyl]-8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-amine;ethane |
| SMILES | C=C(CNc1ncnc2c(OC)cc(-c3ccc(C)cn3)cc12)O/C(C)=C\C.CC |
| InChI | InChI=1S/C22H24N4O2.C2H6/c1-6-15(3)28-16(4)12-24-22-18-9-17(19-8-7-14(2)11-23-19)10-20(27-5)21(18)25-13-26-22;1-2/h6-11,13H,4,12H2,1-3,5H3,(H,24,25,26);1-2H3/b15-6-; |
| InChIKey | IJYHRDUJYYXCRV-PSUINESXSA-N |
| XLogP | 5.90 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|