C17H19BrN4O — CID 155728836
6-bromo-8-methoxy-N-[(Z)-2-methylidene-5-methyliminohex-3-enyl]quinazolin-4-amine (PubChem CID 155728836) has the molecular formula C17H19BrN4O and a molecular weight of 375.27 g/mol. Its IUPAC name is 6-bromo-8-methoxy-N-[(Z)-2-methylidene-5-methyliminohex-3-enyl]quinazolin-4-amine.
| Compound Name | 6-bromo-8-methoxy-N-[(Z)-2-methylidene-5-methyliminohex-3-enyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 155728836 |
| Molecular Formula | C17H19BrN4O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 6-bromo-8-methoxy-N-[(Z)-2-methylidene-5-methyliminohex-3-enyl]quinazolin-4-amine |
| SMILES | C=C(/C=C\C(C)=N\C)CNc1ncnc2c(OC)cc(Br)cc12 |
| InChI | InChI=1S/C17H19BrN4O/c1-11(5-6-12(2)19-3)9-20-17-14-7-13(18)8-15(23-4)16(14)21-10-22-17/h5-8,10H,1,9H2,2-4H3,(H,20,21,22)/b6-5-,19-12+ |
| InChIKey | HPSYVTMDSLOXHH-MKXYTQELSA-N |
| XLogP | 4.02 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|