C20H26N4O10 — CID 166639877
(E)-but-2-enedioic acid;5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentyl nitrate (PubChem CID 166639877) has the molecular formula C20H26N4O10 and a molecular weight of 482.45 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentyl nitrate.
| Compound Name | (E)-but-2-enedioic acid;5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentyl nitrate |
|---|---|
| PubChem CID | 166639877 |
| Molecular Formula | C20H26N4O10 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentyl nitrate |
| SMILES | COc1cc2c(NCCCCCO[N+](=O)[O-])ncnc2c(OC)c1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H22N4O6.C4H4O4/c1-23-12-9-11-13(15(25-3)14(12)24-2)18-10-19-16(11)17-7-5-4-6-8-26-20(21)22;5-3(6)1-2-4(7)8/h9-10H,4-8H2,1-3H3,(H,17,18,19);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HYJLIYABULAXFC-WLHGVMLRSA-N |
| XLogP | 2.16 |
| TPSA | 192.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|