C15H20N4O5 — CID 110435791
3-methoxy-N'-(6,7,8-trimethoxyquinazolin-4-yl)propanehydrazide (PubChem CID 110435791) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-methoxy-N'-(6,7,8-trimethoxyquinazolin-4-yl)propanehydrazide.
| Compound Name | 3-methoxy-N'-(6,7,8-trimethoxyquinazolin-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 110435791 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-methoxy-N'-(6,7,8-trimethoxyquinazolin-4-yl)propanehydrazide |
| SMILES | COCCC(=O)NNc1ncnc2c(OC)c(OC)c(OC)cc12 |
| InChI | InChI=1S/C15H20N4O5/c1-21-6-5-11(20)18-19-15-9-7-10(22-2)13(23-3)14(24-4)12(9)16-8-17-15/h7-8H,5-6H2,1-4H3,(H,18,20)(H,16,17,19) |
| InChIKey | XZAHXAHTSZAHKU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|