C13H17N3O3 — CID 110433384
6,7,8-trimethoxy-N,N-dimethylquinazolin-4-amine (PubChem CID 110433384) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N,N-dimethylquinazolin-4-amine.
| Compound Name | 6,7,8-trimethoxy-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 110433384 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6,7,8-trimethoxy-N,N-dimethylquinazolin-4-amine |
| SMILES | COc1cc2c(N(C)C)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C13H17N3O3/c1-16(2)13-8-6-9(17-3)11(18-4)12(19-5)10(8)14-7-15-13/h6-7H,1-5H3 |
| InChIKey | MFTYHIRQOCLOFR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |