C18H16N4O3 — CID 110435786
4-(benzimidazol-1-yl)-6,7,8-trimethoxyquinazoline (PubChem CID 110435786) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-6,7,8-trimethoxyquinazoline.
| Compound Name | 4-(benzimidazol-1-yl)-6,7,8-trimethoxyquinazoline |
|---|---|
| PubChem CID | 110435786 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-(benzimidazol-1-yl)-6,7,8-trimethoxyquinazoline |
| SMILES | COc1cc2c(-n3cnc4ccccc43)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C18H16N4O3/c1-23-14-8-11-15(17(25-3)16(14)24-2)19-9-20-18(11)22-10-21-12-6-4-5-7-13(12)22/h4-10H,1-3H3 |
| InChIKey | OLCJOCRNIUNTMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |