C19H19N5O4 — CID 171385492
3-[2-(benzotriazol-1-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one (PubChem CID 171385492) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[2-(benzotriazol-1-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one.
| Compound Name | 3-[2-(benzotriazol-1-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 171385492 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[2-(benzotriazol-1-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one |
| SMILES | COc1cc2c(=O)n(CCn3nnc4ccccc43)cnc2c(OC)c1OC |
| InChI | InChI=1S/C19H19N5O4/c1-26-15-10-12-16(18(28-3)17(15)27-2)20-11-23(19(12)25)8-9-24-14-7-5-4-6-13(14)21-22-24/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | WHCOETJYROMTBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |