C17H18N2O4S — CID 171386238
6,7,8-trimethoxy-3-[(5-methylthiophen-2-yl)methyl]quinazolin-4-one (PubChem CID 171386238) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 6,7,8-trimethoxy-3-[(5-methylthiophen-2-yl)methyl]quinazolin-4-one.
| Compound Name | 6,7,8-trimethoxy-3-[(5-methylthiophen-2-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 171386238 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 6,7,8-trimethoxy-3-[(5-methylthiophen-2-yl)methyl]quinazolin-4-one |
| SMILES | COc1cc2c(=O)n(Cc3ccc(C)s3)cnc2c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O4S/c1-10-5-6-11(24-10)8-19-9-18-14-12(17(19)20)7-13(21-2)15(22-3)16(14)23-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | FDOVHACKLWXRKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |