C15H21N3O4 — CID 171910792
3-(4-aminobutyl)-6,7,8-trimethoxyquinazolin-4-one (PubChem CID 171910792) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-(4-aminobutyl)-6,7,8-trimethoxyquinazolin-4-one.
| Compound Name | 3-(4-aminobutyl)-6,7,8-trimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 171910792 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-(4-aminobutyl)-6,7,8-trimethoxyquinazolin-4-one |
| SMILES | COc1cc2c(=O)n(CCCCN)cnc2c(OC)c1OC |
| InChI | InChI=1S/C15H21N3O4/c1-20-11-8-10-12(14(22-3)13(11)21-2)17-9-18(15(10)19)7-5-4-6-16/h8-9H,4-7,16H2,1-3H3 |
| InChIKey | FKYPZKPHRYMCSZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|