C20H20N4O4 — CID 171910845
3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-6,7,8-trimethoxyquinazolin-4-one (PubChem CID 171910845) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-6,7,8-trimethoxyquinazolin-4-one.
| Compound Name | 3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-6,7,8-trimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 171910845 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-6,7,8-trimethoxyquinazolin-4-one |
| SMILES | COc1cc2c(=O)n(CCc3cn4ccccc4n3)cnc2c(OC)c1OC |
| InChI | InChI=1S/C20H20N4O4/c1-26-15-10-14-17(19(28-3)18(15)27-2)21-12-24(20(14)25)9-7-13-11-23-8-5-4-6-16(23)22-13/h4-6,8,10-12H,7,9H2,1-3H3 |
| InChIKey | KJYVRMURSNLMKE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |