C18H25N3O5 — CID 171909580
6,7,8-trimethoxy-3-[(4-methoxypiperidin-4-yl)methyl]quinazolin-4-one (PubChem CID 171909580) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 6,7,8-trimethoxy-3-[(4-methoxypiperidin-4-yl)methyl]quinazolin-4-one.
| Compound Name | 6,7,8-trimethoxy-3-[(4-methoxypiperidin-4-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 171909580 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 6,7,8-trimethoxy-3-[(4-methoxypiperidin-4-yl)methyl]quinazolin-4-one |
| SMILES | COc1cc2c(=O)n(CC3(OC)CCNCC3)cnc2c(OC)c1OC |
| InChI | InChI=1S/C18H25N3O5/c1-23-13-9-12-14(16(25-3)15(13)24-2)20-11-21(17(12)22)10-18(26-4)5-7-19-8-6-18/h9,11,19H,5-8,10H2,1-4H3 |
| InChIKey | OYROHAGPXHOZER-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |