C20H29N3O4 — CID 171388425
3-[2-(1-ethylpiperidin-4-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one (PubChem CID 171388425) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[2-(1-ethylpiperidin-4-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one.
| Compound Name | 3-[2-(1-ethylpiperidin-4-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 171388425 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 3-[2-(1-ethylpiperidin-4-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-one |
| SMILES | CCN1CCC(CCn2cnc3c(OC)c(OC)c(OC)cc3c2=O)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-5-22-9-6-14(7-10-22)8-11-23-13-21-17-15(20(23)24)12-16(25-2)18(26-3)19(17)27-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | ZWMPCPWUJSQCFV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |