C18H25N3O3 — CID 110433380
4-(3,5-dimethylpiperidin-1-yl)-6,7,8-trimethoxyquinazoline (PubChem CID 110433380) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-6,7,8-trimethoxyquinazoline.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-6,7,8-trimethoxyquinazoline |
|---|---|
| PubChem CID | 110433380 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-6,7,8-trimethoxyquinazoline |
| SMILES | COc1cc2c(N3CC(C)CC(C)C3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C18H25N3O3/c1-11-6-12(2)9-21(8-11)18-13-7-14(22-3)16(23-4)17(24-5)15(13)19-10-20-18/h7,10-12H,6,8-9H2,1-5H3 |
| InChIKey | HGHOIZVXLKJYKS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |