C22H24N6O6 — CID 22707512
N-(4-nitrophenyl)-4-(6,7,8-trimethoxyquinazolin-4-yl)piperazine-1-carboxamide (PubChem CID 22707512) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4-(6,7,8-trimethoxyquinazolin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-nitrophenyl)-4-(6,7,8-trimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22707512 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-(4-nitrophenyl)-4-(6,7,8-trimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
| SMILES | COc1cc2c(N3CCN(C(=O)Nc4ccc([N+](=O)[O-])cc4)CC3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C22H24N6O6/c1-32-17-12-16-18(20(34-3)19(17)33-2)23-13-24-21(16)26-8-10-27(11-9-26)22(29)25-14-4-6-15(7-5-14)28(30)31/h4-7,12-13H,8-11H2,1-3H3,(H,25,29) |
| InChIKey | FOLNBYUXHYPHMM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|