C21H21FN6O5 — CID 22707479
4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-fluoro-3-nitrophenyl)piperazine-1-carboxamide (PubChem CID 22707479) has the molecular formula C21H21FN6O5 and a molecular weight of 456.43 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-fluoro-3-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-fluoro-3-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22707479 |
| Molecular Formula | C21H21FN6O5 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-fluoro-3-nitrophenyl)piperazine-1-carboxamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=O)Nc4ccc(F)c([N+](=O)[O-])c4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H21FN6O5/c1-32-18-10-14-16(11-19(18)33-2)23-12-24-20(14)26-5-7-27(8-6-26)21(29)25-13-3-4-15(22)17(9-13)28(30)31/h3-4,9-12H,5-8H2,1-2H3,(H,25,29) |
| InChIKey | MPTYKVXYVSRKDT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|