C20H22N6O3 — CID 11112014
4-(6,7-dimethoxyquinazolin-4-yl)-N-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 11112014) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-N-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 11112014 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=O)Nc4cccnc4)CC3)c2cc1OC |
| InChI | InChI=1S/C20H22N6O3/c1-28-17-10-15-16(11-18(17)29-2)22-13-23-19(15)25-6-8-26(9-7-25)20(27)24-14-4-3-5-21-12-14/h3-5,10-13H,6-9H2,1-2H3,(H,24,27) |
| InChIKey | HKJAUNDAAQAGDN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |