C27H26N6O5 — CID 22707703
4-(6,7-dimethoxy-2-phenylquinazolin-4-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 22707703) has the molecular formula C27H26N6O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-2-phenylquinazolin-4-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(6,7-dimethoxy-2-phenylquinazolin-4-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22707703 |
| Molecular Formula | C27H26N6O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 4-(6,7-dimethoxy-2-phenylquinazolin-4-yl)-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | COc1cc2nc(-c3ccccc3)nc(N3CCN(C(=O)Nc4ccc([N+](=O)[O-])cc4)CC3)c2cc1OC |
| InChI | InChI=1S/C27H26N6O5/c1-37-23-16-21-22(17-24(23)38-2)29-25(18-6-4-3-5-7-18)30-26(21)31-12-14-32(15-13-31)27(34)28-19-8-10-20(11-9-19)33(35)36/h3-11,16-17H,12-15H2,1-2H3,(H,28,34) |
| InChIKey | RUDJTLANSUTKPL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|