C22H25N3O3 — CID 9311249
[(3S)-1-(6,7-dimethoxy-2-phenylquinazolin-4-yl)piperidin-3-yl]methanol (PubChem CID 9311249) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(3S)-1-(6,7-dimethoxy-2-phenylquinazolin-4-yl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(6,7-dimethoxy-2-phenylquinazolin-4-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 9311249 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [(3S)-1-(6,7-dimethoxy-2-phenylquinazolin-4-yl)piperidin-3-yl]methanol |
| SMILES | COc1cc2nc(-c3ccccc3)nc(N3CCC[C@H](CO)C3)c2cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-27-19-11-17-18(12-20(19)28-2)23-21(16-8-4-3-5-9-16)24-22(17)25-10-6-7-15(13-25)14-26/h3-5,8-9,11-12,15,26H,6-7,10,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | SEVDKJCPHREFOE-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |