C26H26N4O — CID 22330526
4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(3-methylphenyl)quinazoline (PubChem CID 22330526) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(3-methylphenyl)quinazoline.
| Compound Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(3-methylphenyl)quinazoline |
|---|---|
| PubChem CID | 22330526 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(3-methylphenyl)quinazoline |
| SMILES | COc1ccccc1N1CCN(c2nc(-c3cccc(C)c3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H26N4O/c1-19-8-7-9-20(18-19)25-27-22-11-4-3-10-21(22)26(28-25)30-16-14-29(15-17-30)23-12-5-6-13-24(23)31-2/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | GETJZTSBIFCUCI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |