C28H30N4O4 — CID 155805514
4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,4,5-trimethoxyphenyl)quinazoline (PubChem CID 155805514) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,4,5-trimethoxyphenyl)quinazoline.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,4,5-trimethoxyphenyl)quinazoline |
|---|---|
| PubChem CID | 155805514 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(3,4,5-trimethoxyphenyl)quinazoline |
| SMILES | COc1ccc(N2CCN(c3nc(-c4cc(OC)c(OC)c(OC)c4)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-33-21-11-9-20(10-12-21)31-13-15-32(16-14-31)28-22-7-5-6-8-23(22)29-27(30-28)19-17-24(34-2)26(36-4)25(18-19)35-3/h5-12,17-18H,13-16H2,1-4H3 |
| InChIKey | RDHTYPFTJAEIQS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|